CAS 98959-90-1 appears in our catalog under these names: 1-[4-(Methylsulfonyl)phenyl]ethanamine hydrochloride, 95%, 1-(4-(Methylsulfonyl)phenyl)ethanamine hydrochloride, 95+%, {1-(4-(Methylsulfonyl)phenyl)ethyl}amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 25g, 1g, 5g, 10g.
1-(4-methylsulfonylphenyl)ethanamine;hydrochloride (CAS 98959-90-1) is a chemical compound with the molecular formula C9H14ClNO2S and a molecular weight of 235.73 g/mol. IUPAC name: 1-(4-methylsulfonylphenyl)ethanamine;hydrochloride. InChIKey: JAECXGZNWPVNEU-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO2S |
|---|---|
| Molecular weight | 235.73 g/mol |
| IUPAC name | 1-(4-methylsulfonylphenyl)ethanamine;hydrochloride |
| InChIKey | JAECXGZNWPVNEU-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)S(=O)(=O)C)N.Cl |
Computed by PubChem (NCBI)