CAS 1093405-12-9 appears in our catalog under these names: 2-(4-Methyl-benzenesulfonyl)ethylamine hydrochloride, 95%, 2-(4-Methyl-benzenesulfonyl)ethylamine Hydrochloride. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g.
2-(4-methylphenyl)sulfonylethanamine;hydrochloride (CAS 1093405-12-9) is a chemical compound with the molecular formula C9H14ClNO2S and a molecular weight of 235.73 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonylethanamine;hydrochloride. InChIKey: HUUJEVONCPRVBV-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO2S |
|---|---|
| Molecular weight | 235.73 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonylethanamine;hydrochloride |
| InChIKey | HUUJEVONCPRVBV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CCN.Cl |
Computed by PubChem (NCBI)