CAS 2375271-23-9 is the registry number for 2-Methanesulfonyl-2-phenylethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methylsulfonyl-2-phenylethanamine;hydrochloride (CAS 2375271-23-9) is a chemical compound with the molecular formula C9H14ClNO2S and a molecular weight of 235.73 g/mol. IUPAC name: 2-methylsulfonyl-2-phenylethanamine;hydrochloride. InChIKey: AESLECIXEOHIHW-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO2S |
|---|---|
| Molecular weight | 235.73 g/mol |
| IUPAC name | 2-methylsulfonyl-2-phenylethanamine;hydrochloride |
| InChIKey | AESLECIXEOHIHW-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C(CN)C1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)