CAS 2714408-51-0 is the registry number for Ofurace-d6, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.
N-[2,6-bis(trideuteriomethyl)phenyl]-2-chloro-N-(2-oxooxolan-3-yl)acetamide (CAS 2714408-51-0) is a chemical compound with the molecular formula C14H16ClNO3 and a molecular weight of 287.77 g/mol. IUPAC name: N-[2,6-bis(trideuteriomethyl)phenyl]-2-chloro-N-(2-oxooxolan-3-yl)acetamide. InChIKey: OWDLFBLNMPCXSD-WFGJKAKNSA-N.
| Molecular formula | C14H16ClNO3 |
|---|---|
| Molecular weight | 287.77 g/mol |
| IUPAC name | N-[2,6-bis(trideuteriomethyl)phenyl]-2-chloro-N-(2-oxooxolan-3-yl)acetamide |
| InChIKey | OWDLFBLNMPCXSD-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=CC=C1)C([2H])([2H])[2H])N(C2CCOC2=O)C(=O)CCl |
Computed by PubChem (NCBI)