CAS 2714432-20-7 is the registry number for 4-(2,2-Dichlorocyclopropyl)phenol-d7. Offered by: TRC. Available pack sizes: 250mg.
2,3,5,6-tetradeuterio-4-(2,2-dichloro-1,3,3-trideuteriocyclopropyl)phenol (CAS 2714432-20-7) is a chemical compound with the molecular formula C9H8Cl2O and a molecular weight of 210.10 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(2,2-dichloro-1,3,3-trideuteriocyclopropyl)phenol. InChIKey: JCHIUDLMOJNKRT-MHKJVSNJSA-N.
| Molecular formula | C9H8Cl2O |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(2,2-dichloro-1,3,3-trideuteriocyclopropyl)phenol |
| InChIKey | JCHIUDLMOJNKRT-MHKJVSNJSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2(C(C2(Cl)Cl)([2H])[2H])[2H])[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)