CAS 27167-27-7 is the registry number for 5-O-Demethylancistroquinone C. Offered by: TRC. Available pack sizes: 100mg.
4,8-dihydroxy-7-methoxy-3-methylnaphthalene-1,2-dione (CAS 27167-27-7) is a chemical compound with the molecular formula C12H10O5 and a molecular weight of 234.20 g/mol. IUPAC name: 4,8-dihydroxy-7-methoxy-3-methylnaphthalene-1,2-dione. InChIKey: BRYVMTSEJKQQKR-UHFFFAOYSA-N.
| Molecular formula | C12H10O5 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 4,8-dihydroxy-7-methoxy-3-methylnaphthalene-1,2-dione |
| InChIKey | BRYVMTSEJKQQKR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C(=C(C=C2)OC)O)C(=O)C1=O)O |
Computed by PubChem (NCBI)