CAS 2718120-81-9 is the registry number for tert-butyl (S)-(4-aminobutan-2-yl)carbamate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
Tert-butyl N-[(2S)-4-aminobutan-2-yl]carbamate;hydrochloride (CAS 2718120-81-9) is a chemical compound with the molecular formula C9H21ClN2O2 and a molecular weight of 224.73 g/mol. IUPAC name: tert-butyl N-[(2S)-4-aminobutan-2-yl]carbamate;hydrochloride. InChIKey: XUYGIQRFKIJQGF-FJXQXJEOSA-N.
| Molecular formula | C9H21ClN2O2 |
|---|---|
| Molecular weight | 224.73 g/mol |
| IUPAC name | tert-butyl N-[(2S)-4-aminobutan-2-yl]carbamate;hydrochloride |
| InChIKey | XUYGIQRFKIJQGF-FJXQXJEOSA-N |
| SMILES | C[C@@H](CCN)NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)