Products 2719003-77-5
CAS 2719003-77-5 is the registry number for (S)-2-(Morpholin-2-yl)benzoic acid hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2-[(2S)-morpholin-2-yl]benzoic acid;hydrochloride (CAS 2719003-77-5) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: 2-[(2S)-morpholin-2-yl]benzoic acid;hydrochloride. InChIKey: JJYZWGXWWOUSCW-HNCPQSOCSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | 2-[(2S)-morpholin-2-yl]benzoic acid;hydrochloride |
| InChIKey | JJYZWGXWWOUSCW-HNCPQSOCSA-N |
| SMILES | C1CO[C@H](CN1)C2=CC=CC=C2C(=O)O.Cl |
Computed by PubChem (NCBI)