Products 2720562-34-3
CAS 2720562-34-3 is the registry number for Aristoquinoline. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(1R,2R,5R)-4,4,8-trimethyl-3-azabicyclo[3.3.1]non-7-en-2-yl]quinoline (CAS 2720562-34-3) is a chemical compound with the molecular formula C20H24N2 and a molecular weight of 292.4 g/mol. IUPAC name: 4-[(1R,2R,5R)-4,4,8-trimethyl-3-azabicyclo[3.3.1]non-7-en-2-yl]quinoline. InChIKey: HQDLJJQZMYAAPU-BJZITVGISA-N.
| Molecular formula | C20H24N2 |
|---|---|
| Molecular weight | 292.4 g/mol |
| IUPAC name | 4-[(1R,2R,5R)-4,4,8-trimethyl-3-azabicyclo[3.3.1]non-7-en-2-yl]quinoline |
| InChIKey | HQDLJJQZMYAAPU-BJZITVGISA-N |
| SMILES | CC1=CC[C@@H]2C[C@H]1[C@@H](NC2(C)C)C3=CC=NC4=CC=CC=C34 |
Computed by PubChem (NCBI)