Products 27221-52-9

CAS 27221-52-9 appears in our catalog under these names: 3,4-Bis(chloromethyl)pyridine hydrochloride, 95%, 3,4-Bis(chloromethyl)pyridine hydrochloride, 97%, 3,4-Bis(chloromethyl)pyridine hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3,4-bis(chloromethyl)pyridine;hydrochloride (CAS 27221-52-9) is a chemical compound with the molecular formula C7H8Cl3N and a molecular weight of 212.5 g/mol. IUPAC name: 3,4-bis(chloromethyl)pyridine;hydrochloride. InChIKey: MOXIJRNFBVTLBE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8Cl3N
Molecular weight212.5 g/mol
IUPAC name3,4-bis(chloromethyl)pyridine;hydrochloride
InChIKeyMOXIJRNFBVTLBE-UHFFFAOYSA-N
SMILESC1=CN=CC(=C1CCl)CCl.Cl

Computed by PubChem (NCBI)