CAS 72955-01-2 appears in our catalog under these names: (2,3-Dichlorophenyl)methanamine hydrochloride, 98%, (2,3-Dichlorophenyl)methanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
(2,3-dichlorophenyl)methanamine;hydrochloride (CAS 72955-01-2) is a chemical compound with the molecular formula C7H8Cl3N and a molecular weight of 212.5 g/mol. IUPAC name: (2,3-dichlorophenyl)methanamine;hydrochloride. InChIKey: ZNIUPNMCCZDQRA-UHFFFAOYSA-N.
| Molecular formula | C7H8Cl3N |
|---|---|
| Molecular weight | 212.5 g/mol |
| IUPAC name | (2,3-dichlorophenyl)methanamine;hydrochloride |
| InChIKey | ZNIUPNMCCZDQRA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CN.Cl |
Computed by PubChem (NCBI)