Products 72955-01-2

CAS 72955-01-2 appears in our catalog under these names: (2,3-Dichlorophenyl)methanamine hydrochloride, 98%, (2,3-Dichlorophenyl)methanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

(2,3-dichlorophenyl)methanamine;hydrochloride (CAS 72955-01-2) is a chemical compound with the molecular formula C7H8Cl3N and a molecular weight of 212.5 g/mol. IUPAC name: (2,3-dichlorophenyl)methanamine;hydrochloride. InChIKey: ZNIUPNMCCZDQRA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8Cl3N
Molecular weight212.5 g/mol
IUPAC name(2,3-dichlorophenyl)methanamine;hydrochloride
InChIKeyZNIUPNMCCZDQRA-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)Cl)CN.Cl

Computed by PubChem (NCBI)