Products 73728-66-2

CAS 73728-66-2 appears in our catalog under these names: Olanexidine Impurity 3, (2,4-Dichlorophenyl)methanamine hydrochloride 95+%, (2,4-Dichlorophenyl)methanamine hydrochloride, 95%, 95%. Offered by: Hubei YoungXin, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(2,4-dichlorophenyl)methanamine;hydrochloride (CAS 73728-66-2) is a chemical compound with the molecular formula C7H8Cl3N and a molecular weight of 212.5 g/mol. IUPAC name: (2,4-dichlorophenyl)methanamine;hydrochloride. InChIKey: IOSPRWNZCSXFRO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8Cl3N
Molecular weight212.5 g/mol
IUPAC name(2,4-dichlorophenyl)methanamine;hydrochloride
InChIKeyIOSPRWNZCSXFRO-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)Cl)CN.Cl

Computed by PubChem (NCBI)