Products 78335-91-8

CAS 78335-91-8 appears in our catalog under these names: (3,5-Dichlorophenyl)methanamine hydrochloride, 95%, (3,5-Dichlorophenyl)methanamine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,25g, 2,5g.

Structural formula: {0} (CAS {1})

(3,5-dichlorophenyl)methanamine;hydrochloride (CAS 78335-91-8) is a chemical compound with the molecular formula C7H8Cl3N and a molecular weight of 212.5 g/mol. IUPAC name: (3,5-dichlorophenyl)methanamine;hydrochloride. InChIKey: WKSHGAUIABDDPD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8Cl3N
Molecular weight212.5 g/mol
IUPAC name(3,5-dichlorophenyl)methanamine;hydrochloride
InChIKeyWKSHGAUIABDDPD-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1Cl)Cl)CN.Cl

Computed by PubChem (NCBI)