CAS 272438-12-7 appears in our catalog under these names: 1-tert-Butyl 5-methyl indoline-1,5-dicarboxylate, 95%, 1-(1,1-Dimethylethyl) 5-methyl 2,3-dihydro-1H-indole-1,5-dicarboxylate, 98%, 98%, 1-TERT-BUTYL 5-METHYL INDOLINE-1,5-DICARBOXYLATE, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
1-O-tert-butyl 5-O-methyl 2,3-dihydroindole-1,5-dicarboxylate (CAS 272438-12-7) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 1-O-tert-butyl 5-O-methyl 2,3-dihydroindole-1,5-dicarboxylate. InChIKey: KANVSPBCQYQXFC-UHFFFAOYSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 1-O-tert-butyl 5-O-methyl 2,3-dihydroindole-1,5-dicarboxylate |
| InChIKey | KANVSPBCQYQXFC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C=CC(=C2)C(=O)OC |
Computed by PubChem (NCBI)