Products 2724465-62-5
CAS 2724465-62-5 is the registry number for Phenylephrine Impurity 46. Offered by: Chemat Brand. Available pack sizes: on request.
[3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenyl] acetate (CAS 2724465-62-5) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: [3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenyl] acetate. InChIKey: HBDKUNQGGSGCMV-NSHDSACASA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | [3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenyl] acetate |
| InChIKey | HBDKUNQGGSGCMV-NSHDSACASA-N |
| SMILES | CC(=O)OC1=CC=CC(=C1)[C@H](CNC)O |
Computed by PubChem (NCBI)