Products 2724727-53-9
CAS 2724727-53-9 is the registry number for Phentolamine Mesilate EP Impurity A (as Oxalate). Offered by: Mikromol. Available pack sizes: 25mg.
N-(2-aminoethyl)-2-(N-(3-hydroxyphenyl)-4-methylanilino)acetamide;oxalic acid (CAS 2724727-53-9) is a chemical compound with the molecular formula C19H23N3O6 and a molecular weight of 389.4 g/mol. IUPAC name: N-(2-aminoethyl)-2-(N-(3-hydroxyphenyl)-4-methylanilino)acetamide;oxalic acid. InChIKey: QPXPXUGCKXSQJS-UHFFFAOYSA-N.
| Molecular formula | C19H23N3O6 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | N-(2-aminoethyl)-2-(N-(3-hydroxyphenyl)-4-methylanilino)acetamide;oxalic acid |
| InChIKey | QPXPXUGCKXSQJS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(CC(=O)NCCN)C2=CC(=CC=C2)O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)