CAS 2725276-82-2 is the registry number for BDE 183-13C6. Offered by: TRC. Available pack sizes: 25mg.
1,2,3,5-tetrabromo-4-(2,4,5-tribromophenoxy)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 2725276-82-2) is a chemical compound with the molecular formula C12H3Br7O and a molecular weight of 728.4 g/mol. IUPAC name: 1,2,3,5-tetrabromo-4-(2,4,5-tribromophenoxy)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: ILPSCQCLBHQUEM-HQRWGFFJSA-N.
| Molecular formula | C12H3Br7O |
|---|---|
| Molecular weight | 728.4 g/mol |
| IUPAC name | 1,2,3,5-tetrabromo-4-(2,4,5-tribromophenoxy)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | ILPSCQCLBHQUEM-HQRWGFFJSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Br)Br)O[13C]2=[13C]([13C](=[13C]([13CH]=[13C]2Br)Br)Br)Br |
Computed by PubChem (NCBI)