CAS 446255-20-5 appears in our catalog under these names: Heptabromo-Diphenyl Ether, 1,2,3,4,5-Pentabromo-6-(2,3-dibromophenoxy)benzene. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
1,2,3,4,5-pentabromo-6-(2,3-dibromophenoxy)benzene (CAS 446255-20-5) is a chemical compound with the molecular formula C12H3Br7O and a molecular weight of 722.5 g/mol. IUPAC name: 1,2,3,4,5-pentabromo-6-(2,3-dibromophenoxy)benzene. InChIKey: NLBLNZDNOSSGPW-UHFFFAOYSA-N.
| Molecular formula | C12H3Br7O |
|---|---|
| Molecular weight | 722.5 g/mol |
| IUPAC name | 1,2,3,4,5-pentabromo-6-(2,3-dibromophenoxy)benzene |
| InChIKey | NLBLNZDNOSSGPW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)Br)OC2=C(C(=C(C(=C2Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)