CAS 446255-30-7 appears in our catalog under these names: 2,3,3',4,4',5',6-Heptabromodiphenyl Ether, PBDE No. 191. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 250mg, 25mg, 5mg.
1,2,3,5-tetrabromo-4-(3,4,5-tribromophenoxy)benzene (CAS 446255-30-7) is a chemical compound with the molecular formula C12H3Br7O and a molecular weight of 722.5 g/mol. IUPAC name: 1,2,3,5-tetrabromo-4-(3,4,5-tribromophenoxy)benzene. InChIKey: BNBFKFHSIPERIM-UHFFFAOYSA-N.
| Molecular formula | C12H3Br7O |
|---|---|
| Molecular weight | 722.5 g/mol |
| IUPAC name | 1,2,3,5-tetrabromo-4-(3,4,5-tribromophenoxy)benzene |
| InChIKey | BNBFKFHSIPERIM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)Br)Br)OC2=C(C(=C(C=C2Br)Br)Br)Br |
Computed by PubChem (NCBI)