CAS 189084-67-1 appears in our catalog under these names: 2,2',3,4,4',5,6-Heptabromodiphenyl Ether, PBDE 181, PBDE No. 181, BDE NO 181 SOLUTION OEKANAL, 505G/ML IN. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Sigma-Aldrich. Available pack sizes: on request, 100mg, 10mg, 50mg, 1ML.
1,2,3,4,5-pentabromo-6-(2,4-dibromophenoxy)benzene (CAS 189084-67-1) is a chemical compound with the molecular formula C12H3Br7O and a molecular weight of 722.5 g/mol. IUPAC name: 1,2,3,4,5-pentabromo-6-(2,4-dibromophenoxy)benzene. InChIKey: GVNRIAPLVGNZPL-UHFFFAOYSA-N.
| Molecular formula | C12H3Br7O |
|---|---|
| Molecular weight | 722.5 g/mol |
| IUPAC name | 1,2,3,4,5-pentabromo-6-(2,4-dibromophenoxy)benzene |
| InChIKey | GVNRIAPLVGNZPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Br)OC2=C(C(=C(C(=C2Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)