CAS 189084-68-2 appears in our catalog under these names: 2,3,3',4,4',5,6-Heptabromodiphenyl Ether, PBDE No. 190, 2,3,3',4,4',5,6–Heptabromodiphenyl Ether. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio. Available pack sizes: on request, 25mg, 5mg, 1mg.
1,2,3,4,5-pentabromo-6-(3,4-dibromophenoxy)benzene (CAS 189084-68-2) is a chemical compound with the molecular formula C12H3Br7O and a molecular weight of 722.5 g/mol. IUPAC name: 1,2,3,4,5-pentabromo-6-(3,4-dibromophenoxy)benzene. InChIKey: OUEYHQIMJGHOQN-UHFFFAOYSA-N.
| Molecular formula | C12H3Br7O |
|---|---|
| Molecular weight | 722.5 g/mol |
| IUPAC name | 1,2,3,4,5-pentabromo-6-(3,4-dibromophenoxy)benzene |
| InChIKey | OUEYHQIMJGHOQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC2=C(C(=C(C(=C2Br)Br)Br)Br)Br)Br)Br |
Computed by PubChem (NCBI)