CAS 27311-25-7 appears in our catalog under these names: 2-(1H-Pyrrolo[3,2-b]pyridin-3-yl)ethanamine dihydrochloride, 95%, 2-(1H-Pyrrolo(3,2-b)pyridin-3-yl)ethanamine dihydrochloride, 98%, 2–(1H–Pyrrolo(3,2–b)pyridin–3–yl)ethanamine dihydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
2-(1H-pyrrolo[3,2-b]pyridin-3-yl)ethanamine;dihydrochloride (CAS 27311-25-7) is a chemical compound with the molecular formula C9H13Cl2N3 and a molecular weight of 234.12 g/mol. IUPAC name: 2-(1H-pyrrolo[3,2-b]pyridin-3-yl)ethanamine;dihydrochloride. InChIKey: RAQGXXRFNJEAAN-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N3 |
|---|---|
| Molecular weight | 234.12 g/mol |
| IUPAC name | 2-(1H-pyrrolo[3,2-b]pyridin-3-yl)ethanamine;dihydrochloride |
| InChIKey | RAQGXXRFNJEAAN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN2)CCN)N=C1.Cl.Cl |
Computed by PubChem (NCBI)