CAS 2732834-81-8 appears in our catalog under these names: MCPB D6 (ring D3, methyl D3), MCPB D6 (ring D3, methyl D3) 100 µg/mL in Acetone. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10mg, 1ml.
4-[4-chloro-2,3,5-trideuterio-6-(trideuteriomethyl)phenoxy]butanoic acid (CAS 2732834-81-8) is a chemical compound with the molecular formula C11H13ClO3 and a molecular weight of 234.71 g/mol. IUPAC name: 4-[4-chloro-2,3,5-trideuterio-6-(trideuteriomethyl)phenoxy]butanoic acid. InChIKey: LLWADFLAOKUBDR-VQMZQCFLSA-N.
| Molecular formula | C11H13ClO3 |
|---|---|
| Molecular weight | 234.71 g/mol |
| IUPAC name | 4-[4-chloro-2,3,5-trideuterio-6-(trideuteriomethyl)phenoxy]butanoic acid |
| InChIKey | LLWADFLAOKUBDR-VQMZQCFLSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OCCCC(=O)O)C([2H])([2H])[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)