Products 2733388-70-8
CAS 2733388-70-8 is the registry number for 2-((Heptyloxy)carbonyl)benzoic acid-d4. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,3,4,5-tetradeuterio-6-heptoxycarbonylbenzoic acid (CAS 2733388-70-8) is a chemical compound with the molecular formula C15H20O4 and a molecular weight of 268.34 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-heptoxycarbonylbenzoic acid. InChIKey: DMVQNBGDYPFJCC-NECLWFIRSA-N.
| Molecular formula | C15H20O4 |
|---|---|
| Molecular weight | 268.34 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-heptoxycarbonylbenzoic acid |
| InChIKey | DMVQNBGDYPFJCC-NECLWFIRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCCCCCCC)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Monoheptyl phthalate-d4