Products 2733969-33-8
CAS 2733969-33-8 appears in our catalog under these names: Methiocarb-d3 Sulfone, Methiocarb sulfone-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg.
(3,5-dimethyl-4-methylsulfonylphenyl) N-(trideuteriomethyl)carbamate (CAS 2733969-33-8) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 260.33 g/mol. IUPAC name: (3,5-dimethyl-4-methylsulfonylphenyl) N-(trideuteriomethyl)carbamate. InChIKey: RJBJMKAMQIOAML-HPRDVNIFSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | (3,5-dimethyl-4-methylsulfonylphenyl) N-(trideuteriomethyl)carbamate |
| InChIKey | RJBJMKAMQIOAML-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)OC1=CC(=C(C(=C1)C)S(=O)(=O)C)C |
Computed by PubChem (NCBI)