Products 1181973-93-2
CAS 1181973-93-2 appears in our catalog under these names: {N-[(2-Methylphenyl)methyl]methanesulfonamido}acetic acid, 95%, {N-((2-Methylphenyl)methyl)methanesulfonamido}acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
2-[(2-methylphenyl)methyl-methylsulfonylamino]acetic acid (CAS 1181973-93-2) is a chemical compound with the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. IUPAC name: 2-[(2-methylphenyl)methyl-methylsulfonylamino]acetic acid. InChIKey: RCGUNTXKUJOSJT-UHFFFAOYSA-N.
| Molecular formula | C11H15NO4S |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | 2-[(2-methylphenyl)methyl-methylsulfonylamino]acetic acid |
| InChIKey | RCGUNTXKUJOSJT-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1CN(CC(=O)O)S(=O)(=O)C |
Computed by PubChem (NCBI)