CAS 2734867-37-7 is the registry number for Benzyl ((1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[(1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate (CAS 2734867-37-7) is a chemical compound with the molecular formula C14H18N2O2 and a molecular weight of 246.30 g/mol. IUPAC name: benzyl N-[(1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate. InChIKey: DCIDUMCKQHBCJL-YNEHKIRRSA-N.
| Molecular formula | C14H18N2O2 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | benzyl N-[(1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate |
| InChIKey | DCIDUMCKQHBCJL-YNEHKIRRSA-N |
| SMILES | C1C[C@@H]2[C@@H](C[C@H]1N2)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)