Products 2734867-38-8
CAS 2734867-38-8 is the registry number for Benzyl ((1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-yl)carbamate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[(1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;hydrochloride (CAS 2734867-38-8) is a chemical compound with the molecular formula C14H19ClN2O2 and a molecular weight of 282.76 g/mol. IUPAC name: benzyl N-[(1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;hydrochloride. InChIKey: LRWWKTWCQOVPCY-LUHWTZLKSA-N.
| Molecular formula | C14H19ClN2O2 |
|---|---|
| Molecular weight | 282.76 g/mol |
| IUPAC name | benzyl N-[(1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-yl]carbamate;hydrochloride |
| InChIKey | LRWWKTWCQOVPCY-LUHWTZLKSA-N |
| SMILES | C1C[C@@H]2[C@@H](C[C@H]1N2)NC(=O)OCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)