Products 27392-15-0

CAS 27392-15-0 is the registry number for rac-(1R,2S)-2-tert-Butylcyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Cis-(1S,2R)-2-tert-butylcyclohexane-1-carboxylic acid (CAS 27392-15-0) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 184.27 g/mol. IUPAC name: cis-(1S,2R)-2-tert-butylcyclohexane-1-carboxylic acid. InChIKey: FVPFFBYHXHQMCY-DTWKUNHWSA-N.

Identity
Molecular formulaC11H20O2
Molecular weight184.27 g/mol
IUPAC namecis-(1S,2R)-2-tert-butylcyclohexane-1-carboxylic acid
InChIKeyFVPFFBYHXHQMCY-DTWKUNHWSA-N
SMILESCC(C)(C)[C@@H]1CCCC[C@@H]1C(=O)O

Computed by PubChem (NCBI)