Products 27392-16-1

CAS 27392-16-1 appears in our catalog under these names: trans-2-(tert-Butyl)cyclohexane-1-carboxylic acid, 97%, rac-(1R,2R)-2-tert-Butylcyclohexane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Trans-(1R,2R)-2-tert-butylcyclohexane-1-carboxylic acid (CAS 27392-16-1) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 184.27 g/mol. IUPAC name: trans-(1R,2R)-2-tert-butylcyclohexane-1-carboxylic acid. InChIKey: FVPFFBYHXHQMCY-RKDXNWHRSA-N.

Identity
Molecular formulaC11H20O2
Molecular weight184.27 g/mol
IUPAC nametrans-(1R,2R)-2-tert-butylcyclohexane-1-carboxylic acid
InChIKeyFVPFFBYHXHQMCY-RKDXNWHRSA-N
SMILESCC(C)(C)[C@@H]1CCCC[C@H]1C(=O)O

Computed by PubChem (NCBI)