Products 2739618-53-0
CAS 2739618-53-0 is the registry number for cyclopropylmethyl 3-bromobenzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Cyclopropylmethyl 3-bromobenzoate (CAS 2739618-53-0) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: cyclopropylmethyl 3-bromobenzoate. InChIKey: BWMPXVGKYASQFQ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | cyclopropylmethyl 3-bromobenzoate |
| InChIKey | BWMPXVGKYASQFQ-UHFFFAOYSA-N |
| SMILES | C1CC1COC(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)
Synonyms:
Cyclopropylmethyl 3-bromobenZoate