Products 2740660-22-2
CAS 2740660-22-2 is the registry number for 3-(1-aminocyclopentyl)aniline,dihydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-(1-aminocyclopentyl)aniline;dihydrochloride (CAS 2740660-22-2) is a chemical compound with the molecular formula C11H18Cl2N2 and a molecular weight of 249.18 g/mol. IUPAC name: 3-(1-aminocyclopentyl)aniline;dihydrochloride. InChIKey: LEXVZRSTEAILHO-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2 |
|---|---|
| Molecular weight | 249.18 g/mol |
| IUPAC name | 3-(1-aminocyclopentyl)aniline;dihydrochloride |
| InChIKey | LEXVZRSTEAILHO-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC(=CC=C2)N)N.Cl.Cl |
Computed by PubChem (NCBI)