Products 2740660-78-8
CAS 2740660-78-8 is the registry number for 3-(4-(Aminomethyl)phenyl)oxazolidin-2-one hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-[4-(aminomethyl)phenyl]-1,3-oxazolidin-2-one;hydrochloride (CAS 2740660-78-8) is a chemical compound with the molecular formula C10H13ClN2O2 and a molecular weight of 228.67 g/mol. IUPAC name: 3-[4-(aminomethyl)phenyl]-1,3-oxazolidin-2-one;hydrochloride. InChIKey: HIPJVMDZVSENJS-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O2 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | 3-[4-(aminomethyl)phenyl]-1,3-oxazolidin-2-one;hydrochloride |
| InChIKey | HIPJVMDZVSENJS-UHFFFAOYSA-N |
| SMILES | C1COC(=O)N1C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)