Products 2743442-36-4
CAS 2743442-36-4 appears in our catalog under these names: 1-(2,6-Dioxopiperidin-3-yl)-1H-pyrazole-4-carboxylic acid, 98%, 98%, 1-(2,6-Dioxopiperidin-3-yl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(2,6-dioxopiperidin-3-yl)pyrazole-4-carboxylic acid (CAS 2743442-36-4) is a chemical compound with the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. IUPAC name: 1-(2,6-dioxopiperidin-3-yl)pyrazole-4-carboxylic acid. InChIKey: HNCQZTOJADZGIP-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O4 |
|---|---|
| Molecular weight | 223.19 g/mol |
| IUPAC name | 1-(2,6-dioxopiperidin-3-yl)pyrazole-4-carboxylic acid |
| InChIKey | HNCQZTOJADZGIP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)