CAS 27469-61-0 appears in our catalog under these names: 1-(bis(4-chlorophenyl)methyl)piperazine, 1-(4,4'-Dichlorobenzhydryl)piperazine, 98%. Offered by: Biosynth, Fluorochem. Available pack sizes: 5g, 250mg.
1-[bis(4-chlorophenyl)methyl]piperazine (CAS 27469-61-0) is a chemical compound with the molecular formula C17H18Cl2N2 and a molecular weight of 321.2 g/mol. IUPAC name: 1-[bis(4-chlorophenyl)methyl]piperazine. InChIKey: PTLFMGDNZYQISN-UHFFFAOYSA-N.
| Molecular formula | C17H18Cl2N2 |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 1-[bis(4-chlorophenyl)methyl]piperazine |
| InChIKey | PTLFMGDNZYQISN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)