Products 2747914-61-8
CAS 2747914-61-8 is the registry number for N-Desmethyl Nefopam-d4 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
3,3,4,4-tetradeuterio-1-phenyl-5,6-dihydro-1H-2,5-benzoxazocine;hydrochloride (CAS 2747914-61-8) is a chemical compound with the molecular formula C16H18ClNO and a molecular weight of 279.80 g/mol. IUPAC name: 3,3,4,4-tetradeuterio-1-phenyl-5,6-dihydro-1H-2,5-benzoxazocine;hydrochloride. InChIKey: ODDJBKRAHHWMJP-DEHBLRELSA-N.
| Molecular formula | C16H18ClNO |
|---|---|
| Molecular weight | 279.80 g/mol |
| IUPAC name | 3,3,4,4-tetradeuterio-1-phenyl-5,6-dihydro-1H-2,5-benzoxazocine;hydrochloride |
| InChIKey | ODDJBKRAHHWMJP-DEHBLRELSA-N |
| SMILES | [2H]C1(C(OC(C2=CC=CC=C2CN1)C3=CC=CC=C3)([2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)