CAS 2749329-28-8 is the registry number for 7-Ethoxyresorufin-d5, 98.89%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 1 mg.
7-(1,1,2,2,2-pentadeuterioethoxy)phenoxazin-3-one (CAS 2749329-28-8) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 246.27 g/mol. IUPAC name: 7-(1,1,2,2,2-pentadeuterioethoxy)phenoxazin-3-one. InChIKey: CRCWUBLTFGOMDD-ZBJDZAJPSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 246.27 g/mol |
| IUPAC name | 7-(1,1,2,2,2-pentadeuterioethoxy)phenoxazin-3-one |
| InChIKey | CRCWUBLTFGOMDD-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=CC2=C(C=C1)N=C3C=CC(=O)C=C3O2 |
Computed by PubChem (NCBI)