CAS 1147-43-9 appears in our catalog under these names: 2-Aminobenzophenone-2'-carboxylic acid, 98%, 2–(2–Aminobenzoyl)benzoic acid, 2'-Aminobenzophenone-2-carboxylic Acid, >98.0%(HPLC)(T), 2-AMINOBENZOPHENONE-2'-CARBOXYLIC ACID,&, 2-(2-Aminobenzoyl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 250mg.
2-(2-aminobenzoyl)benzoic acid (CAS 1147-43-9) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: 2-(2-aminobenzoyl)benzoic acid. InChIKey: KORKIRUGUNPQML-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 2-(2-aminobenzoyl)benzoic acid |
| InChIKey | KORKIRUGUNPQML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CC=C2N)C(=O)O |
Computed by PubChem (NCBI)