CAS 65819-31-0 appears in our catalog under these names: 3-Hydroxy-4'-nitrostilbene, 95%, 3-Hydroxy-4'-nitrostilbene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
3-[2-(4-nitrophenyl)ethenyl]phenol (CAS 65819-31-0) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: 3-[2-(4-nitrophenyl)ethenyl]phenol. InChIKey: KSHDNGNLHTYEAS-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 3-[2-(4-nitrophenyl)ethenyl]phenol |
| InChIKey | KSHDNGNLHTYEAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C=CC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)