CAS 16777-78-9 appears in our catalog under these names: 4-(Phenylcarbamoyl)benzoic acid, 98%, 4-(Phenylcarbamoyl)benzoic Acid. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 2,5g.
4-(phenylcarbamoyl)benzoic acid (CAS 16777-78-9) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: 4-(phenylcarbamoyl)benzoic acid. InChIKey: LNCHBBZGCITQPQ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 4-(phenylcarbamoyl)benzoic acid |
| InChIKey | LNCHBBZGCITQPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)