CAS 158822-84-5 is the registry number for 6-Benzyloxy-2-benzoxazolinone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-phenylmethoxy-3H-1,3-benzoxazol-2-one (CAS 158822-84-5) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: 6-phenylmethoxy-3H-1,3-benzoxazol-2-one. InChIKey: JVUPJESJQYCFOB-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 6-phenylmethoxy-3H-1,3-benzoxazol-2-one |
| InChIKey | JVUPJESJQYCFOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)NC(=O)O3 |
Computed by PubChem (NCBI)