CAS 2750620-47-2 is the registry number for 3-Cyano-4-propylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyano-4-propylbenzoic acid (CAS 2750620-47-2) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 3-cyano-4-propylbenzoic acid. InChIKey: IYEFTNVYQPXSFX-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 3-cyano-4-propylbenzoic acid |
| InChIKey | IYEFTNVYQPXSFX-UHFFFAOYSA-N |
| SMILES | CCCC1=C(C=C(C=C1)C(=O)O)C#N |
Computed by PubChem (NCBI)