CAS 2750707-50-5 appears in our catalog under these names: 4,4'-(1-Ethyl-1H-benzo[d]imidazole-4,7-diyl)dibenzaldehyde, 95%, 95%, 4,4'-(1-Ethyl-1H-benzo[d]imidazole-4,7-diyl)dibenzaldehyde, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-[1-ethyl-7-(4-formylphenyl)benzimidazol-4-yl]benzaldehyde (CAS 2750707-50-5) is a chemical compound with the molecular formula C23H18N2O2 and a molecular weight of 354.4 g/mol. IUPAC name: 4-[1-ethyl-7-(4-formylphenyl)benzimidazol-4-yl]benzaldehyde. InChIKey: HDBKTUGKRDXWDJ-UHFFFAOYSA-N.
| Molecular formula | C23H18N2O2 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 4-[1-ethyl-7-(4-formylphenyl)benzimidazol-4-yl]benzaldehyde |
| InChIKey | HDBKTUGKRDXWDJ-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=C(C=CC(=C21)C3=CC=C(C=C3)C=O)C4=CC=C(C=C4)C=O |
Computed by PubChem (NCBI)