CAS 2751620-36-5 appears in our catalog under these names: 3-(4-(Trifluoromethyl)phenyl)azetidin-3-ol hydrochloride, 98%, 3-[4-(Trifluoromethyl)phenyl]-3-azetidinol hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100mg, 500mg.
3-[4-(trifluoromethyl)phenyl]azetidin-3-ol;hydrochloride (CAS 2751620-36-5) is a chemical compound with the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]azetidin-3-ol;hydrochloride. InChIKey: JQBKCTBKDWATPB-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO |
|---|---|
| Molecular weight | 253.65 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]azetidin-3-ol;hydrochloride |
| InChIKey | JQBKCTBKDWATPB-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C2=CC=C(C=C2)C(F)(F)F)O.Cl |
Computed by PubChem (NCBI)