Products 2751621-53-9
CAS 2751621-53-9 appears in our catalog under these names: N-Phenylpiperidin-3-Amine Dihydrochloride, 97%, 97%, 3-Anilinopiperidine (dihydrochloride), 97.0%, N-Phenylpiperidin-3-amine dihydrochloride, 97%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 1 g, 500 mg, 100 mg, 250 mg, 50mg, 250mg, 500mg.
N-phenylpiperidin-3-amine;dihydrochloride (CAS 2751621-53-9) is a chemical compound with the molecular formula C11H18Cl2N2 and a molecular weight of 249.18 g/mol. IUPAC name: N-phenylpiperidin-3-amine;dihydrochloride. InChIKey: DFZJZMCUQQGWKE-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2 |
|---|---|
| Molecular weight | 249.18 g/mol |
| IUPAC name | N-phenylpiperidin-3-amine;dihydrochloride |
| InChIKey | DFZJZMCUQQGWKE-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)NC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)