CAS 275378-91-1 appears in our catalog under these names: N-((1R)-1-(Hydroxymethyl)-2-phenylethyl)urea, Solriamfetol Impurity 6. Offered by: TRC, Chemat Brand. Available pack sizes: 500mg, on request.
[(2R)-1-hydroxy-3-phenylpropan-2-yl]urea (CAS 275378-91-1) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: [(2R)-1-hydroxy-3-phenylpropan-2-yl]urea. InChIKey: NJVZDURTFWBXAM-SECBINFHSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | [(2R)-1-hydroxy-3-phenylpropan-2-yl]urea |
| InChIKey | NJVZDURTFWBXAM-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](CO)NC(=O)N |
Computed by PubChem (NCBI)