Products 2754275-70-0
CAS 2754275-70-0 is the registry number for tert-Butyl 8-oxo-6-thioxo-5,7-diazaspiro[3.4]octane-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octane-5-carboxylate (CAS 2754275-70-0) is a chemical compound with the molecular formula C11H16N2O3S and a molecular weight of 256.32 g/mol. IUPAC name: tert-butyl 8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octane-5-carboxylate. InChIKey: DSXIRIDFRFHUAS-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O3S |
|---|---|
| Molecular weight | 256.32 g/mol |
| IUPAC name | tert-butyl 8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octane-5-carboxylate |
| InChIKey | DSXIRIDFRFHUAS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(=S)NC(=O)C12CCC2 |
Computed by PubChem (NCBI)