CAS 2755313-03-0 is the registry number for 1-(3,3-Dimethylbutanoyl)azetidine-3-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,3-dimethylbutanoyl)azetidine-3-carbaldehyde (CAS 2755313-03-0) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: 1-(3,3-dimethylbutanoyl)azetidine-3-carbaldehyde. InChIKey: JRHBGMUFNCAAGJ-UHFFFAOYSA-N.
| Molecular formula | C10H17NO2 |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 1-(3,3-dimethylbutanoyl)azetidine-3-carbaldehyde |
| InChIKey | JRHBGMUFNCAAGJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(=O)N1CC(C1)C=O |
Computed by PubChem (NCBI)