Products 2757012-29-4
CAS 2757012-29-4 is the registry number for 6-bromo-2,2-dimethyl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-2,2-dimethyl-3H-[1,4]dioxino[2,3-b]pyridine (CAS 2757012-29-4) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: 6-bromo-2,2-dimethyl-3H-[1,4]dioxino[2,3-b]pyridine. InChIKey: FQRHNAADSQRWMF-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | 6-bromo-2,2-dimethyl-3H-[1,4]dioxino[2,3-b]pyridine |
| InChIKey | FQRHNAADSQRWMF-UHFFFAOYSA-N |
| SMILES | CC1(COC2=C(O1)C=CC(=N2)Br)C |
Computed by PubChem (NCBI)