Products 2757248-24-9
CAS 2757248-24-9 is the registry number for [1,1':3',1'':3'',1'''-Quaterphenyl]-4,4''',5',5''-tetracarbaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[3-formyl-5-(4-formylphenyl)phenyl]-5-(4-formylphenyl)benzaldehyde (CAS 2757248-24-9) is a chemical compound with the molecular formula C28H18O4 and a molecular weight of 418.4 g/mol. IUPAC name: 3-[3-formyl-5-(4-formylphenyl)phenyl]-5-(4-formylphenyl)benzaldehyde. InChIKey: GYCBJWPJBSBNNV-UHFFFAOYSA-N.
| Molecular formula | C28H18O4 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 3-[3-formyl-5-(4-formylphenyl)phenyl]-5-(4-formylphenyl)benzaldehyde |
| InChIKey | GYCBJWPJBSBNNV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC(=CC(=C2)C=O)C3=CC(=CC(=C3)C4=CC=C(C=C4)C=O)C=O |
Computed by PubChem (NCBI)